C30H21Cl2N3O2S — CID 11766867
2-carbazol-9-yl-N-[(5Z)-2-(2-chlorophenyl)-5-[(2-chlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 11766867) has the molecular formula C30H21Cl2N3O2S and a molecular weight of 558.49 g/mol. Its IUPAC name is 2-carbazol-9-yl-N-[(5Z)-2-(2-chlorophenyl)-5-[(2-chlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | 2-carbazol-9-yl-N-[(5Z)-2-(2-chlorophenyl)-5-[(2-chlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 11766867 |
| Molecular Formula | C30H21Cl2N3O2S |
| Molecular Weight | 558.49 g/mol |
| Exact Mass | 557.07 |
| IUPAC Name | 2-carbazol-9-yl-N-[(5Z)-2-(2-chlorophenyl)-5-[(2-chlorophenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(Cn1c2ccccc2c2ccccc21)NN1C(=O)/C(=C/c2ccccc2Cl)SC1c1ccccc1Cl |
| InChI | InChI=1S/C30H21Cl2N3O2S/c31-23-13-5-1-9-19(23)17-27-29(37)35(30(38-27)22-12-2-6-14-24(22)32)33-28(36)18-34-25-15-7-3-10-20(25)21-11-4-8-16-26(21)34/h1-17,30H,18H2,(H,33,36)/b27-17- |
| InChIKey | KFUCMUJSZDEZML-PKAZHMFMSA-N |
| XLogP | 7.45 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.49 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|