C27H30N4O5 — CID 11123811
2-[6-amino-5-cyano-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]-N-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)acetamide (PubChem CID 11123811) has the molecular formula C27H30N4O5 and a molecular weight of 490.56 g/mol. Its IUPAC name is 2-[6-amino-5-cyano-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]-N-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[6-amino-5-cyano-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]-N-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 11123811 |
| Molecular Formula | C27H30N4O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 2-[6-amino-5-cyano-4-(3,4,5-trimethoxyphenyl)-2-pyridinyl]-N-(4-hydroxy-2-methyl-5-propan-2-ylphenyl)acetamide |
| SMILES | COc1cc(-c2cc(CC(=O)Nc3cc(C(C)C)c(O)cc3C)nc(N)c2C#N)cc(OC)c1OC |
| InChI | InChI=1S/C27H30N4O5/c1-14(2)18-12-21(15(3)7-22(18)32)31-25(33)11-17-10-19(20(13-28)27(29)30-17)16-8-23(34-4)26(36-6)24(9-16)35-5/h7-10,12,14,32H,11H2,1-6H3,(H2,29,30)(H,31,33) |
| InChIKey | MYZQBJHOIQNYMJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|