C22H27NO3 — CID 122220607
2,6-di(propan-2-yl)-4-(3,4,5-trimethoxyphenyl)benzonitrile (PubChem CID 122220607) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 2,6-di(propan-2-yl)-4-(3,4,5-trimethoxyphenyl)benzonitrile.
| Compound Name | 2,6-di(propan-2-yl)-4-(3,4,5-trimethoxyphenyl)benzonitrile |
|---|---|
| PubChem CID | 122220607 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 2,6-di(propan-2-yl)-4-(3,4,5-trimethoxyphenyl)benzonitrile |
| SMILES | COc1cc(-c2cc(C(C)C)c(C#N)c(C(C)C)c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H27NO3/c1-13(2)17-8-15(9-18(14(3)4)19(17)12-23)16-10-20(24-5)22(26-7)21(11-16)25-6/h8-11,13-14H,1-7H3 |
| InChIKey | WBKWMAOVPPFSGY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |