C25H26N4O7 — CID 135488028
2-amino-6-(4-butoxy-2-hydroxy-5-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)pyridine-3-carbonitrile (PubChem CID 135488028) has the molecular formula C25H26N4O7 and a molecular weight of 494.50 g/mol. Its IUPAC name is 2-amino-6-(4-butoxy-2-hydroxy-5-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(4-butoxy-2-hydroxy-5-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135488028 |
| Molecular Formula | C25H26N4O7 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 2-amino-6-(4-butoxy-2-hydroxy-5-nitrophenyl)-4-(3,4,5-trimethoxyphenyl)pyridine-3-carbonitrile |
| SMILES | CCCCOc1cc(O)c(-c2cc(-c3cc(OC)c(OC)c(OC)c3)c(C#N)c(N)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H26N4O7/c1-5-6-7-36-21-12-20(30)16(11-19(21)29(31)32)18-10-15(17(13-26)25(27)28-18)14-8-22(33-2)24(35-4)23(9-14)34-3/h8-12,30H,5-7H2,1-4H3,(H2,27,28) |
| InChIKey | OYFWWEAHYPFSSF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 162.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|