C23H26N4O7 — CID 135848314
N-[4-(4-butoxy-2-hydroxyphenyl)-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]nitramide (PubChem CID 135848314) has the molecular formula C23H26N4O7 and a molecular weight of 470.48 g/mol. Its IUPAC name is N-[4-(4-butoxy-2-hydroxyphenyl)-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]nitramide.
| Compound Name | N-[4-(4-butoxy-2-hydroxyphenyl)-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]nitramide |
|---|---|
| PubChem CID | 135848314 |
| Molecular Formula | C23H26N4O7 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | N-[4-(4-butoxy-2-hydroxyphenyl)-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]nitramide |
| SMILES | CCCCOc1ccc(-c2cc(-c3cc(OC)c(OC)c(OC)c3)nc(N[N+](=O)[O-])n2)c(O)c1 |
| InChI | InChI=1S/C23H26N4O7/c1-5-6-9-34-15-7-8-16(19(28)12-15)18-13-17(24-23(25-18)26-27(29)30)14-10-20(31-2)22(33-4)21(11-14)32-3/h7-8,10-13,28H,5-6,9H2,1-4H3,(H,24,25,26) |
| InChIKey | RVTLQVSDQACBLH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 138.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|