C35H49N7O6 — CID 11125209
(3S)-3-[[(2S)-2-[[(3S)-3-acetamido-4-phenylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-7-amino-N-[(3R,4S)-1-amino-4-hydroxy-1-oxopentan-3-yl]heptanamide (PubChem CID 11125209) has the molecular formula C35H49N7O6 and a molecular weight of 663.82 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[(3S)-3-acetamido-4-phenylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-7-amino-N-[(3R,4S)-1-amino-4-hydroxy-1-oxopentan-3-yl]heptanamide.
| Compound Name | (3S)-3-[[(2S)-2-[[(3S)-3-acetamido-4-phenylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-7-amino-N-[(3R,4S)-1-amino-4-hydroxy-1-oxopentan-3-yl]heptanamide |
|---|---|
| PubChem CID | 11125209 |
| Molecular Formula | C35H49N7O6 |
| Molecular Weight | 663.82 g/mol |
| Exact Mass | 663.37 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[(3S)-3-acetamido-4-phenylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-7-amino-N-[(3R,4S)-1-amino-4-hydroxy-1-oxopentan-3-yl]heptanamide |
| SMILES | CC(=O)N[C@H](CC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCCCN)CC(=O)N[C@H](CC(N)=O)[C@H](C)O)Cc1ccccc1 |
| InChI | InChI=1S/C35H49N7O6/c1-22(43)30(20-32(37)45)41-33(46)18-26(12-8-9-15-36)40-35(48)31(17-25-21-38-29-14-7-6-13-28(25)29)42-34(47)19-27(39-23(2)44)16-24-10-4-3-5-11-24/h3-7,10-11,13-14,21-22,26-27,30-31,38,43H,8-9,12,15-20,36H2,1-2H3,(H2,37,45)(H,39,44)(H,40,48)(H,41,46)(H,42,47)/t22-,26-,27-,30+,31-/m0/s1 |
| InChIKey | KHDCYTMXCLFRCQ-COJZPGRWSA-N |
| XLogP | 1.08 |
| TPSA | 221.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.82 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|