About 1-ethenyl-3,4-dihydrophenanthrene
1-ethenyl-3,4-dihydrophenanthrene (PubChem CID 11127443) has the molecular formula C16H14
and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-ethenyl-3,4-dihydrophenanthrene.
Molecular Properties
| Compound Name | 1-ethenyl-3,4-dihydrophenanthrene |
| PubChem CID | 11127443 |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-ethenyl-3,4-dihydrophenanthrene |
| SMILES | C=CC1=CCCc2c1ccc1ccccc21 |
| InChI | InChI=1S/C16H14/c1-2-12-7-5-9-16-14-8-4-3-6-13(14)10-11-15(12)16/h2-4,6-8,10-11H,1,5,9H2 |
| InChIKey | VRCKCXQPRCCPKL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethenyl-3,4-dihydrophenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-3,4-dihydrophenanthrene?
The IUPAC name of 1-ethenyl-3,4-dihydrophenanthrene (CID 11127443) is 1-ethenyl-3,4-dihydrophenanthrene.
What is the SMILES notation for 1-ethenyl-3,4-dihydrophenanthrene?
The canonical SMILES for 1-ethenyl-3,4-dihydrophenanthrene is C=CC1=CCCc2c1ccc1ccccc21.
What is the InChIKey of 1-ethenyl-3,4-dihydrophenanthrene?
The InChIKey is VRCKCXQPRCCPKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14/c1-2-12-7-5-9-16-14-8-4-3-6-13(14)10-11-15(12)16/h2-4,6-8,10-11H,1,5,9H2.
What are the key properties of 1-ethenyl-3,4-dihydrophenanthrene?
1-ethenyl-3,4-dihydrophenanthrene has a molecular weight of 206.29 g/mol, XLogP of 4.36, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-3,4-dihydrophenanthrene is sourced from PubChem (CID 11127443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).