C23H27FN4O3 — CID 111296399
1-[(2,4-dimethoxyphenyl)methyl]-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-1,2-dimethylguanidine (PubChem CID 111296399) has the molecular formula C23H27FN4O3 and a molecular weight of 426.49 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111296399 |
| Molecular Formula | C23H27FN4O3 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCCc1coc(-c2ccc(F)cc2)n1)N(C)Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C23H27FN4O3/c1-25-23(28(2)14-17-7-10-20(29-3)13-21(17)30-4)26-12-11-19-15-31-22(27-19)16-5-8-18(24)9-6-16/h5-10,13,15H,11-12,14H2,1-4H3,(H,25,26) |
| InChIKey | ALAJTCKIFMAEQE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 72.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|