C22H26FIN4OS — CID 111299004
3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111299004) has the molecular formula C22H26FIN4OS and a molecular weight of 540.45 g/mol. Its IUPAC name is 3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111299004 |
| Molecular Formula | C22H26FIN4OS |
| Molecular Weight | 540.45 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | 3-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1coc(-c2ccc(F)cc2)n1)N(C)Cc1ccc(SC)cc1.I |
| InChI | InChI=1S/C22H25FN4OS.HI/c1-24-22(27(2)14-16-4-10-20(29-3)11-5-16)25-13-12-19-15-28-21(26-19)17-6-8-18(23)9-7-17;/h4-11,15H,12-14H2,1-3H3,(H,24,25);1H |
| InChIKey | UVXPYVKPVAJVDU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|