C23H31N5O2 — CID 111298129
1-[1-(3,4-diethoxyphenyl)ethyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine (PubChem CID 111298129) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-[1-(3,4-diethoxyphenyl)ethyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine.
| Compound Name | 1-[1-(3,4-diethoxyphenyl)ethyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111298129 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 1-[1-(3,4-diethoxyphenyl)ethyl]-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)-2-methylguanidine |
| SMILES | CCOc1ccc(C(C)N/C(=N\C)NCCc2cn3ccccc3n2)cc1OCC |
| InChI | InChI=1S/C23H31N5O2/c1-5-29-20-11-10-18(15-21(20)30-6-2)17(3)26-23(24-4)25-13-12-19-16-28-14-8-7-9-22(28)27-19/h7-11,14-17H,5-6,12-13H2,1-4H3,(H2,24,25,26) |
| InChIKey | RHCDNYAMSPPHQU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|