C12H14O8S — CID 11130938
ethyl 5-[(3aS,4R,6aR)-2,2-dioxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiol-4-yl]-2-methylfuran-3-carboxylate (PubChem CID 11130938) has the molecular formula C12H14O8S and a molecular weight of 318.30 g/mol. Its IUPAC name is ethyl 5-[(3aS,4R,6aR)-2,2-dioxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiol-4-yl]-2-methylfuran-3-carboxylate.
| Compound Name | ethyl 5-[(3aS,4R,6aR)-2,2-dioxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiol-4-yl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 11130938 |
| Molecular Formula | C12H14O8S |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | ethyl 5-[(3aS,4R,6aR)-2,2-dioxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiol-4-yl]-2-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1cc([C@@H]2OC[C@H]3OS(=O)(=O)O[C@H]32)oc1C |
| InChI | InChI=1S/C12H14O8S/c1-3-16-12(13)7-4-8(18-6(7)2)10-11-9(5-17-10)19-21(14,15)20-11/h4,9-11H,3,5H2,1-2H3/t9-,10+,11-/m1/s1 |
| InChIKey | MQNRHVCFQIGFNG-OUAUKWLOSA-N |
| XLogP | 0.86 |
| TPSA | 101.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |