C12H16O6 — CID 134856562
ethyl 5-[(2S,3R)-3-[(1R)-1,2-dihydroxyethyl]oxiran-2-yl]-2-methylfuran-3-carboxylate (PubChem CID 134856562) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is ethyl 5-[(2S,3R)-3-[(1R)-1,2-dihydroxyethyl]oxiran-2-yl]-2-methylfuran-3-carboxylate.
| Compound Name | ethyl 5-[(2S,3R)-3-[(1R)-1,2-dihydroxyethyl]oxiran-2-yl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 134856562 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | ethyl 5-[(2S,3R)-3-[(1R)-1,2-dihydroxyethyl]oxiran-2-yl]-2-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)c1cc([C@H]2O[C@@H]2[C@H](O)CO)oc1C |
| InChI | InChI=1S/C12H16O6/c1-3-16-12(15)7-4-9(17-6(7)2)11-10(18-11)8(14)5-13/h4,8,10-11,13-14H,3,5H2,1-2H3/t8-,10-,11-/m1/s1 |
| InChIKey | GIZNIJPESVLYCI-FBIMIBRVSA-N |
| XLogP | 0.56 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|