C14H19F3O8S2 — CID 11015617
ethyl 5-[(2R,3R,4S)-3,4-dihydroxy-1-methylthiolan-1-ium-2-yl]-2-methylfuran-3-carboxylate;trifluoromethanesulfonate (PubChem CID 11015617) has the molecular formula C14H19F3O8S2 and a molecular weight of 436.43 g/mol. Its IUPAC name is ethyl 5-[(2R,3R,4S)-3,4-dihydroxy-1-methylthiolan-1-ium-2-yl]-2-methylfuran-3-carboxylate;trifluoromethanesulfonate.
| Compound Name | ethyl 5-[(2R,3R,4S)-3,4-dihydroxy-1-methylthiolan-1-ium-2-yl]-2-methylfuran-3-carboxylate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11015617 |
| Molecular Formula | C14H19F3O8S2 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | ethyl 5-[(2R,3R,4S)-3,4-dihydroxy-1-methylthiolan-1-ium-2-yl]-2-methylfuran-3-carboxylate;trifluoromethanesulfonate |
| SMILES | CCOC(=O)c1cc([C@H]2[C@H](O)[C@H](O)C[S+]2C)oc1C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C13H19O5S.CHF3O3S/c1-4-17-13(16)8-5-10(18-7(8)2)12-11(15)9(14)6-19(12)3;2-1(3,4)8(5,6)7/h5,9,11-12,14-15H,4,6H2,1-3H3;(H,5,6,7)/q+1;/p-1/t9-,11-,12+,19?;/m1./s1 |
| InChIKey | LMUVADPPFUFJHQ-XBRNUMNTSA-M |
| XLogP | 0.84 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|