C15H29NO7 — CID 11131463
(3S,4R)-4-(2-methoxyethoxymethoxy)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 11131463) has the molecular formula C15H29NO7 and a molecular weight of 335.40 g/mol. Its IUPAC name is (3S,4R)-4-(2-methoxyethoxymethoxy)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (3S,4R)-4-(2-methoxyethoxymethoxy)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 11131463 |
| Molecular Formula | C15H29NO7 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | (3S,4R)-4-(2-methoxyethoxymethoxy)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CC[C@@H](OCOCCOC)[C@H](CC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29NO7/c1-6-12(22-10-21-8-7-20-5)11(9-13(17)18)16-14(19)23-15(2,3)4/h11-12H,6-10H2,1-5H3,(H,16,19)(H,17,18)/t11-,12+/m0/s1 |
| InChIKey | LHWGLYNIFKZSHQ-NWDGAFQWSA-N |
| XLogP | 1.77 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|