C14H29NO6 — CID 15458662
tert-butyl N-[(2S,3S)-1-hydroxy-3-(2-methoxyethoxymethoxy)pentan-2-yl]carbamate (PubChem CID 15458662) has the molecular formula C14H29NO6 and a molecular weight of 307.39 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-1-hydroxy-3-(2-methoxyethoxymethoxy)pentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-1-hydroxy-3-(2-methoxyethoxymethoxy)pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 15458662 |
| Molecular Formula | C14H29NO6 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | tert-butyl N-[(2S,3S)-1-hydroxy-3-(2-methoxyethoxymethoxy)pentan-2-yl]carbamate |
| SMILES | CC[C@H](OCOCCOC)[C@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H29NO6/c1-6-12(20-10-19-8-7-18-5)11(9-16)15-13(17)21-14(2,3)4/h11-12,16H,6-10H2,1-5H3,(H,15,17)/t11-,12-/m0/s1 |
| InChIKey | KCZBRAJGFYCIRY-RYUDHWBXSA-N |
| XLogP | 1.29 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|