C21H43NO10 — CID 57385689
tert-butyl N-[(2S,3S,4S,5R)-3,4,5-tris(ethoxymethoxy)-1,7-dihydroxyheptan-2-yl]carbamate (PubChem CID 57385689) has the molecular formula C21H43NO10 and a molecular weight of 469.57 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,4S,5R)-3,4,5-tris(ethoxymethoxy)-1,7-dihydroxyheptan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,4S,5R)-3,4,5-tris(ethoxymethoxy)-1,7-dihydroxyheptan-2-yl]carbamate |
|---|---|
| PubChem CID | 57385689 |
| Molecular Formula | C21H43NO10 |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | tert-butyl N-[(2S,3S,4S,5R)-3,4,5-tris(ethoxymethoxy)-1,7-dihydroxyheptan-2-yl]carbamate |
| SMILES | CCOCO[C@H]([C@@H](OCOCC)[C@@H](CCO)OCOCC)[C@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H43NO10/c1-7-26-13-29-17(10-11-23)19(31-15-28-9-3)18(30-14-27-8-2)16(12-24)22-20(25)32-21(4,5)6/h16-19,23-24H,7-15H2,1-6H3,(H,22,25)/t16-,17+,18-,19-/m0/s1 |
| InChIKey | UKLIODJGUOXSGU-RDGPPVDQSA-N |
| XLogP | 1.39 |
| TPSA | 134.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|