C22H24N6 — CID 111321796
2-methyl-1-(1-naphthalen-2-ylethyl)-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine (PubChem CID 111321796) has the molecular formula C22H24N6 and a molecular weight of 372.48 g/mol. Its IUPAC name is 2-methyl-1-(1-naphthalen-2-ylethyl)-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine.
| Compound Name | 2-methyl-1-(1-naphthalen-2-ylethyl)-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111321796 |
| Molecular Formula | C22H24N6 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 2-methyl-1-(1-naphthalen-2-ylethyl)-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCc1nnc2ccccn12)NC(C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H24N6/c1-16(18-11-10-17-7-3-4-8-19(17)15-18)25-22(23-2)24-13-12-21-27-26-20-9-5-6-14-28(20)21/h3-11,14-16H,12-13H2,1-2H3,(H2,23,24,25) |
| InChIKey | GJZATUKQQASXAM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|