C20H26N6O2 — CID 111378388
1-[1-(2,5-dimethoxyphenyl)ethyl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine (PubChem CID 111378388) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 1-[1-(2,5-dimethoxyphenyl)ethyl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine.
| Compound Name | 1-[1-(2,5-dimethoxyphenyl)ethyl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111378388 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 1-[1-(2,5-dimethoxyphenyl)ethyl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
| SMILES | C/N=C(/NCCc1nnc2ccccn12)NC(C)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C20H26N6O2/c1-14(16-13-15(27-3)8-9-17(16)28-4)23-20(21-2)22-11-10-19-25-24-18-7-5-6-12-26(18)19/h5-9,12-14H,10-11H2,1-4H3,(H2,21,22,23) |
| InChIKey | JRVPBAUGCLBJCV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|