C21H34ClIN4O2 — CID 111325621
4-[(4-chlorophenyl)methyl]-N'-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111325621) has the molecular formula C21H34ClIN4O2 and a molecular weight of 536.89 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-N'-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-[(4-chlorophenyl)methyl]-N'-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111325621 |
| Molecular Formula | C21H34ClIN4O2 |
| Molecular Weight | 536.89 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-N'-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(O)COCC1CC1)N1CCN(Cc2ccc(Cl)cc2)CC1.I |
| InChI | InChI=1S/C21H33ClN4O2.HI/c1-2-23-21(24-13-20(27)16-28-15-18-3-4-18)26-11-9-25(10-12-26)14-17-5-7-19(22)8-6-17;/h5-8,18,20,27H,2-4,9-16H2,1H3,(H,23,24);1H |
| InChIKey | UEIJGZFKMZXKSH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.89 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|