C22H36N4O2 — CID 111347546
N'-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-N-ethyl-4-[(3-methylphenyl)methyl]piperazine-1-carboximidamide (PubChem CID 111347546) has the molecular formula C22H36N4O2 and a molecular weight of 388.56 g/mol. Its IUPAC name is N'-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-N-ethyl-4-[(3-methylphenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | N'-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-N-ethyl-4-[(3-methylphenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111347546 |
| Molecular Formula | C22H36N4O2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | N'-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-N-ethyl-4-[(3-methylphenyl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(O)COCC1CC1)N1CCN(Cc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C22H36N4O2/c1-3-23-22(24-14-21(27)17-28-16-19-7-8-19)26-11-9-25(10-12-26)15-20-6-4-5-18(2)13-20/h4-6,13,19,21,27H,3,7-12,14-17H2,1-2H3,(H,23,24) |
| InChIKey | QGQMHMWWBTVKKA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|