C17H27NO2 — CID 111332758
2-[2-[propyl(1,2,3,4-tetrahydronaphthalen-2-yl)amino]ethoxy]ethanol (PubChem CID 111332758) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-[2-[propyl(1,2,3,4-tetrahydronaphthalen-2-yl)amino]ethoxy]ethanol.
| Compound Name | 2-[2-[propyl(1,2,3,4-tetrahydronaphthalen-2-yl)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 111332758 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2-[2-[propyl(1,2,3,4-tetrahydronaphthalen-2-yl)amino]ethoxy]ethanol |
| SMILES | CCCN(CCOCCO)C1CCc2ccccc2C1 |
| InChI | InChI=1S/C17H27NO2/c1-2-9-18(10-12-20-13-11-19)17-8-7-15-5-3-4-6-16(15)14-17/h3-6,17,19H,2,7-14H2,1H3 |
| InChIKey | MYDRNWXYDQEJBX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|