C24H44O6Si — CID 11134255
methyl (E)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methyl-8-(oxan-2-yloxy)-3-oxooct-6-enoate (PubChem CID 11134255) has the molecular formula C24H44O6Si and a molecular weight of 456.70 g/mol. Its IUPAC name is methyl (E)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methyl-8-(oxan-2-yloxy)-3-oxooct-6-enoate.
| Compound Name | methyl (E)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methyl-8-(oxan-2-yloxy)-3-oxooct-6-enoate |
|---|---|
| PubChem CID | 11134255 |
| Molecular Formula | C24H44O6Si |
| Molecular Weight | 456.70 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | methyl (E)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-methyl-8-(oxan-2-yloxy)-3-oxooct-6-enoate |
| SMILES | COC(=O)C(CCCO[Si](C)(C)C(C)(C)C)C(=O)CC/C(C)=C/COC1CCCCO1 |
| InChI | InChI=1S/C24H44O6Si/c1-19(15-18-29-22-12-8-9-16-28-22)13-14-21(25)20(23(26)27-5)11-10-17-30-31(6,7)24(2,3)4/h15,20,22H,8-14,16-18H2,1-7H3/b19-15+ |
| InChIKey | ZXCZHTCCBOGAIL-XDJHFCHBSA-N |
| XLogP | 5.42 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.70 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|