C10H16INO — CID 11140903
2-ethoxy-3,4-diethyl-5-iodo-1H-pyrrole (PubChem CID 11140903) has the molecular formula C10H16INO and a molecular weight of 293.15 g/mol. Its IUPAC name is 2-ethoxy-3,4-diethyl-5-iodo-1H-pyrrole.
| Compound Name | 2-ethoxy-3,4-diethyl-5-iodo-1H-pyrrole |
|---|---|
| PubChem CID | 11140903 |
| Molecular Formula | C10H16INO |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 2-ethoxy-3,4-diethyl-5-iodo-1H-pyrrole |
| SMILES | CCOc1[nH]c(I)c(CC)c1CC |
| InChI | InChI=1S/C10H16INO/c1-4-7-8(5-2)10(13-6-3)12-9(7)11/h12H,4-6H2,1-3H3 |
| InChIKey | CKYYINFXEVCEOJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|