About CID 11141647
CID 11141647 (PubChem CID 11141647) has the molecular formula C19H19N
and a molecular weight of 261.37 g/mol.
Molecular Properties
| Compound Name | CID 11141647 |
| PubChem CID | 11141647 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][CH][C](CN(C[C]2[CH][CH][CH][CH]2)Cc2ccccc2)[CH]1 |
| InChI | InChI=1S/C19H19N/c1-2-8-17(9-3-1)14-20(15-18-10-4-5-11-18)16-19-12-6-7-13-19/h1-13H,14-16H2 |
| InChIKey | DVUCQZGTKPOXEV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 11141647 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11141647?
The IUPAC name of CID 11141647 (CID 11141647) is not available.
What is the SMILES notation for CID 11141647?
The canonical SMILES for CID 11141647 is [CH]1[CH][CH][C](CN(C[C]2[CH][CH][CH][CH]2)Cc2ccccc2)[CH]1.
What is the InChIKey of CID 11141647?
The InChIKey is DVUCQZGTKPOXEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N/c1-2-8-17(9-3-1)14-20(15-18-10-4-5-11-18)16-19-12-6-7-13-19/h1-13H,14-16H2.
What are the key properties of CID 11141647?
CID 11141647 has a molecular weight of 261.37 g/mol, XLogP of 3.30, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11141647 is sourced from PubChem (CID 11141647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).