C18H25NO5 — CID 111434957
1-[3-(5-ethylfuran-2-yl)morpholin-4-yl]-3-(furan-2-ylmethoxy)propan-2-ol (PubChem CID 111434957) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-[3-(5-ethylfuran-2-yl)morpholin-4-yl]-3-(furan-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-[3-(5-ethylfuran-2-yl)morpholin-4-yl]-3-(furan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 111434957 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1-[3-(5-ethylfuran-2-yl)morpholin-4-yl]-3-(furan-2-ylmethoxy)propan-2-ol |
| SMILES | CCc1ccc(C2COCCN2CC(O)COCc2ccco2)o1 |
| InChI | InChI=1S/C18H25NO5/c1-2-15-5-6-18(24-15)17-13-21-9-7-19(17)10-14(20)11-22-12-16-4-3-8-23-16/h3-6,8,14,17,20H,2,7,9-13H2,1H3 |
| InChIKey | GJBGPUKELTXPPF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 68.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |