C26H43NO5S — CID 11145303
4-[(2S,3R)-5-oxo-3-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-yl]butyl methanesulfonate (PubChem CID 11145303) has the molecular formula C26H43NO5S and a molecular weight of 481.70 g/mol. Its IUPAC name is 4-[(2S,3R)-5-oxo-3-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-yl]butyl methanesulfonate.
| Compound Name | 4-[(2S,3R)-5-oxo-3-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-yl]butyl methanesulfonate |
|---|---|
| PubChem CID | 11145303 |
| Molecular Formula | C26H43NO5S |
| Molecular Weight | 481.70 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | 4-[(2S,3R)-5-oxo-3-[(1S)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-yl]butyl methanesulfonate |
| SMILES | CC(C)c1cc(C(C)C)c([C@H](C)O[C@@H]2CC(=O)N[C@H]2CCCCOS(C)(=O)=O)c(C(C)C)c1 |
| InChI | InChI=1S/C26H43NO5S/c1-16(2)20-13-21(17(3)4)26(22(14-20)18(5)6)19(7)32-24-15-25(28)27-23(24)11-9-10-12-31-33(8,29)30/h13-14,16-19,23-24H,9-12,15H2,1-8H3,(H,27,28)/t19-,23-,24+/m0/s1 |
| InChIKey | GJHPVNMUVLVWJF-WDJPJFJCSA-N |
| XLogP | 5.54 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.70 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|