C25H39Cl2NO2 — CID 10742447
(4R,5S)-3,3-dichloro-5-(2-methylpropyl)-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one (PubChem CID 10742447) has the molecular formula C25H39Cl2NO2 and a molecular weight of 456.50 g/mol. Its IUPAC name is (4R,5S)-3,3-dichloro-5-(2-methylpropyl)-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one.
| Compound Name | (4R,5S)-3,3-dichloro-5-(2-methylpropyl)-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one |
|---|---|
| PubChem CID | 10742447 |
| Molecular Formula | C25H39Cl2NO2 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | (4R,5S)-3,3-dichloro-5-(2-methylpropyl)-4-[(1R)-1-[2,4,6-tri(propan-2-yl)phenyl]ethoxy]pyrrolidin-2-one |
| SMILES | CC(C)C[C@@H]1NC(=O)C(Cl)(Cl)[C@@H]1O[C@H](C)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C25H39Cl2NO2/c1-13(2)10-21-23(25(26,27)24(29)28-21)30-17(9)22-19(15(5)6)11-18(14(3)4)12-20(22)16(7)8/h11-17,21,23H,10H2,1-9H3,(H,28,29)/t17-,21+,23-/m1/s1 |
| InChIKey | BZJNEJCBMFCREL-FRGLQRNOSA-N |
| XLogP | 7.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|