C16H20ClNO3 — CID 111476517
1-[2-(3-chlorophenyl)-2-hydroxyethyl]-3,3-diethylpyrrolidine-2,5-dione (PubChem CID 111476517) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)-2-hydroxyethyl]-3,3-diethylpyrrolidine-2,5-dione.
| Compound Name | 1-[2-(3-chlorophenyl)-2-hydroxyethyl]-3,3-diethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 111476517 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-[2-(3-chlorophenyl)-2-hydroxyethyl]-3,3-diethylpyrrolidine-2,5-dione |
| SMILES | CCC1(CC)CC(=O)N(CC(O)c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C16H20ClNO3/c1-3-16(4-2)9-14(20)18(15(16)21)10-13(19)11-6-5-7-12(17)8-11/h5-8,13,19H,3-4,9-10H2,1-2H3 |
| InChIKey | WNUQAAMMPVUVJA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|