C11H18N2O3S2 — CID 111488137
2-[[2-(methylsulfonylmethyl)-1,3-thiazol-4-yl]methyl-prop-2-enylamino]ethanol (PubChem CID 111488137) has the molecular formula C11H18N2O3S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-[[2-(methylsulfonylmethyl)-1,3-thiazol-4-yl]methyl-prop-2-enylamino]ethanol.
| Compound Name | 2-[[2-(methylsulfonylmethyl)-1,3-thiazol-4-yl]methyl-prop-2-enylamino]ethanol |
|---|---|
| PubChem CID | 111488137 |
| Molecular Formula | C11H18N2O3S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-[[2-(methylsulfonylmethyl)-1,3-thiazol-4-yl]methyl-prop-2-enylamino]ethanol |
| SMILES | C=CCN(CCO)Cc1csc(CS(C)(=O)=O)n1 |
| InChI | InChI=1S/C11H18N2O3S2/c1-3-4-13(5-6-14)7-10-8-17-11(12-10)9-18(2,15)16/h3,8,14H,1,4-7,9H2,2H3 |
| InChIKey | XUFUYDSGAUAFGC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|