C12H20N2O2S — CID 111612970
2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-prop-2-enylamino]ethanol (PubChem CID 111612970) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-prop-2-enylamino]ethanol.
| Compound Name | 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-prop-2-enylamino]ethanol |
|---|---|
| PubChem CID | 111612970 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl-prop-2-enylamino]ethanol |
| SMILES | C=CCN(CCO)Cc1csc(C(C)OC)n1 |
| InChI | InChI=1S/C12H20N2O2S/c1-4-5-14(6-7-15)8-11-9-17-12(13-11)10(2)16-3/h4,9-10,15H,1,5-8H2,2-3H3 |
| InChIKey | VBDLNARKXUUWHO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|