C15H20O5 — CID 11150188
methyl (4aR,8aS)-4,4-dimethoxy-7-methyl-3-oxo-4a,5,8,8a-tetrahydronaphthalene-1-carboxylate (PubChem CID 11150188) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl (4aR,8aS)-4,4-dimethoxy-7-methyl-3-oxo-4a,5,8,8a-tetrahydronaphthalene-1-carboxylate.
| Compound Name | methyl (4aR,8aS)-4,4-dimethoxy-7-methyl-3-oxo-4a,5,8,8a-tetrahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 11150188 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | methyl (4aR,8aS)-4,4-dimethoxy-7-methyl-3-oxo-4a,5,8,8a-tetrahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)C1=CC(=O)C(OC)(OC)[C@@H]2CC=C(C)C[C@H]12 |
| InChI | InChI=1S/C15H20O5/c1-9-5-6-12-10(7-9)11(14(17)18-2)8-13(16)15(12,19-3)20-4/h5,8,10,12H,6-7H2,1-4H3/t10-,12-/m1/s1 |
| InChIKey | HNPJIQOKOVMTGA-ZYHUDNBSSA-N |
| XLogP | 1.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|