C22H20N4O — CID 11152486
(1S,3R)-3-[[6-(4-methylphenyl)purin-9-yl]methyl]-2,3-dihydro-1H-inden-1-ol (PubChem CID 11152486) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is (1S,3R)-3-[[6-(4-methylphenyl)purin-9-yl]methyl]-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1S,3R)-3-[[6-(4-methylphenyl)purin-9-yl]methyl]-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 11152486 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (1S,3R)-3-[[6-(4-methylphenyl)purin-9-yl]methyl]-2,3-dihydro-1H-inden-1-ol |
| SMILES | Cc1ccc(-c2ncnc3c2ncn3C[C@@H]2C[C@H](O)c3ccccc32)cc1 |
| InChI | InChI=1S/C22H20N4O/c1-14-6-8-15(9-7-14)20-21-22(24-12-23-20)26(13-25-21)11-16-10-19(27)18-5-3-2-4-17(16)18/h2-9,12-13,16,19,27H,10-11H2,1H3/t16-,19-/m0/s1 |
| InChIKey | MOJOFOVYOXVPCU-LPHOPBHVSA-N |
| XLogP | 4.02 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |