C22H20N4O — CID 102378672
[(1R,3S)-3-[(6-phenylpurin-9-yl)methyl]-2,3-dihydro-1H-inden-1-yl]methanol (PubChem CID 102378672) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is [(1R,3S)-3-[(6-phenylpurin-9-yl)methyl]-2,3-dihydro-1H-inden-1-yl]methanol.
| Compound Name | [(1R,3S)-3-[(6-phenylpurin-9-yl)methyl]-2,3-dihydro-1H-inden-1-yl]methanol |
|---|---|
| PubChem CID | 102378672 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | [(1R,3S)-3-[(6-phenylpurin-9-yl)methyl]-2,3-dihydro-1H-inden-1-yl]methanol |
| SMILES | OC[C@@H]1C[C@H](Cn2cnc3c(-c4ccccc4)ncnc32)c2ccccc21 |
| InChI | InChI=1S/C22H20N4O/c27-12-17-10-16(18-8-4-5-9-19(17)18)11-26-14-25-21-20(23-13-24-22(21)26)15-6-2-1-3-7-15/h1-9,13-14,16-17,27H,10-12H2/t16-,17+/m1/s1 |
| InChIKey | ZDZSPAHZWYOZNN-SJORKVTESA-N |
| XLogP | 3.76 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |