C17H25BrO5 — CID 11153473
(4R,6R)-6-[(1S,2E,4E,6R,8E)-9-bromo-1-hydroxy-6-methoxy-3-methylnona-2,4,8-trienyl]-4-methoxyoxan-2-one (PubChem CID 11153473) has the molecular formula C17H25BrO5 and a molecular weight of 389.29 g/mol. Its IUPAC name is (4R,6R)-6-[(1S,2E,4E,6R,8E)-9-bromo-1-hydroxy-6-methoxy-3-methylnona-2,4,8-trienyl]-4-methoxyoxan-2-one.
| Compound Name | (4R,6R)-6-[(1S,2E,4E,6R,8E)-9-bromo-1-hydroxy-6-methoxy-3-methylnona-2,4,8-trienyl]-4-methoxyoxan-2-one |
|---|---|
| PubChem CID | 11153473 |
| Molecular Formula | C17H25BrO5 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | (4R,6R)-6-[(1S,2E,4E,6R,8E)-9-bromo-1-hydroxy-6-methoxy-3-methylnona-2,4,8-trienyl]-4-methoxyoxan-2-one |
| SMILES | CO[C@H]1CC(=O)O[C@@H]([C@@H](O)/C=C(C)/C=C/[C@@H](C/C=C/Br)OC)C1 |
| InChI | InChI=1S/C17H25BrO5/c1-12(6-7-13(21-2)5-4-8-18)9-15(19)16-10-14(22-3)11-17(20)23-16/h4,6-9,13-16,19H,5,10-11H2,1-3H3/b7-6+,8-4+,12-9+/t13-,14-,15+,16-/m1/s1 |
| InChIKey | CJFSGVLAHYHGTP-BAJQEDIZSA-N |
| XLogP | 2.88 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|