C16H28O5Si — CID 89203680
(4R,6R)-6-[(1R,2E,4E,6S)-1,6-dihydroxy-3-methyl-7-trimethylsilylhepta-2,4-dienyl]-4-hydroxyoxan-2-one (PubChem CID 89203680) has the molecular formula C16H28O5Si and a molecular weight of 328.48 g/mol. Its IUPAC name is (4R,6R)-6-[(1R,2E,4E,6S)-1,6-dihydroxy-3-methyl-7-trimethylsilylhepta-2,4-dienyl]-4-hydroxyoxan-2-one.
| Compound Name | (4R,6R)-6-[(1R,2E,4E,6S)-1,6-dihydroxy-3-methyl-7-trimethylsilylhepta-2,4-dienyl]-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 89203680 |
| Molecular Formula | C16H28O5Si |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (4R,6R)-6-[(1R,2E,4E,6S)-1,6-dihydroxy-3-methyl-7-trimethylsilylhepta-2,4-dienyl]-4-hydroxyoxan-2-one |
| SMILES | CC(/C=C/[C@H](O)C[Si](C)(C)C)=C\[C@@H](O)[C@H]1C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C16H28O5Si/c1-11(5-6-12(17)10-22(2,3)4)7-14(19)15-8-13(18)9-16(20)21-15/h5-7,12-15,17-19H,8-10H2,1-4H3/b6-5+,11-7+/t12-,13+,14+,15+/m0/s1 |
| InChIKey | YYMSSVQQPFJVDS-NUKALSOFSA-N |
| XLogP | 1.62 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|