C26H48O5Si — CID 91101863
(4R,6R)-4-methoxy-6-[(1R,6R)-6-methoxy-3-methyl-1-tri(propan-2-yl)silyloxynona-2,4-dienyl]oxan-2-one (PubChem CID 91101863) has the molecular formula C26H48O5Si and a molecular weight of 468.75 g/mol. Its IUPAC name is (4R,6R)-4-methoxy-6-[(1R,6R)-6-methoxy-3-methyl-1-tri(propan-2-yl)silyloxynona-2,4-dienyl]oxan-2-one.
| Compound Name | (4R,6R)-4-methoxy-6-[(1R,6R)-6-methoxy-3-methyl-1-tri(propan-2-yl)silyloxynona-2,4-dienyl]oxan-2-one |
|---|---|
| PubChem CID | 91101863 |
| Molecular Formula | C26H48O5Si |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | (4R,6R)-4-methoxy-6-[(1R,6R)-6-methoxy-3-methyl-1-tri(propan-2-yl)silyloxynona-2,4-dienyl]oxan-2-one |
| SMILES | CCC[C@H](C=CC(C)=C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1C[C@@H](OC)CC(=O)O1)OC |
| InChI | InChI=1S/C26H48O5Si/c1-11-12-22(28-9)14-13-21(8)15-25(24-16-23(29-10)17-26(27)30-24)31-32(18(2)3,19(4)5)20(6)7/h13-15,18-20,22-25H,11-12,16-17H2,1-10H3/t22-,23-,24-,25-/m1/s1 |
| InChIKey | GXQXNQYCKUOIJI-ZGFBMJKBSA-N |
| XLogP | 6.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|