C27H34N2O4 — CID 11155161
5-[(1R)-2-[[2-(hexoxymethyl)-1,3-dihydroinden-2-yl]amino]-1-hydroxyethyl]-7-hydroxy-1H-quinolin-2-one (PubChem CID 11155161) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is 5-[(1R)-2-[[2-(hexoxymethyl)-1,3-dihydroinden-2-yl]amino]-1-hydroxyethyl]-7-hydroxy-1H-quinolin-2-one.
| Compound Name | 5-[(1R)-2-[[2-(hexoxymethyl)-1,3-dihydroinden-2-yl]amino]-1-hydroxyethyl]-7-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 11155161 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 5-[(1R)-2-[[2-(hexoxymethyl)-1,3-dihydroinden-2-yl]amino]-1-hydroxyethyl]-7-hydroxy-1H-quinolin-2-one |
| SMILES | CCCCCCOCC1(NC[C@H](O)c2cc(O)cc3[nH]c(=O)ccc23)Cc2ccccc2C1 |
| InChI | InChI=1S/C27H34N2O4/c1-2-3-4-7-12-33-18-27(15-19-8-5-6-9-20(19)16-27)28-17-25(31)23-13-21(30)14-24-22(23)10-11-26(32)29-24/h5-6,8-11,13-14,25,28,30-31H,2-4,7,12,15-18H2,1H3,(H,29,32)/t25-/m0/s1 |
| InChIKey | SJRDLEHDYLUFIO-VWLOTQADSA-N |
| XLogP | 3.99 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|