C16H32F3N5O2S — CID 111559360
1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine (PubChem CID 111559360) has the molecular formula C16H32F3N5O2S and a molecular weight of 415.53 g/mol. Its IUPAC name is 1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111559360 |
| Molecular Formula | C16H32F3N5O2S |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
| SMILES | C/N=C(/NCC1CCN(S(=O)(=O)C(F)(F)F)CC1)NCC(C)(C)CN(C)C |
| InChI | InChI=1S/C16H32F3N5O2S/c1-15(2,12-23(4)5)11-22-14(20-3)21-10-13-6-8-24(9-7-13)27(25,26)16(17,18)19/h13H,6-12H2,1-5H3,(H2,20,21,22) |
| InChIKey | ORJPWNJYFWZAHG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|