C13H25F3N4O3S — CID 111829217
1-(1-methoxypropan-2-yl)-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine (PubChem CID 111829217) has the molecular formula C13H25F3N4O3S and a molecular weight of 374.43 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yl)-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 1-(1-methoxypropan-2-yl)-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111829217 |
| Molecular Formula | C13H25F3N4O3S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 1-(1-methoxypropan-2-yl)-2-methyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
| SMILES | C/N=C(/NCC1CCN(S(=O)(=O)C(F)(F)F)CC1)NC(C)COC |
| InChI | InChI=1S/C13H25F3N4O3S/c1-10(9-23-3)19-12(17-2)18-8-11-4-6-20(7-5-11)24(21,22)13(14,15)16/h10-11H,4-9H2,1-3H3,(H2,17,18,19) |
| InChIKey | XOWZAOPUJKGGBB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|