C22H44Cl2O4Ti — CID 11156044
dichlorotitanium;bis(5-hydroxy-2,2,6,6-tetramethylheptan-3-one) (PubChem CID 11156044) has the molecular formula C22H44Cl2O4Ti and a molecular weight of 491.36 g/mol. Its IUPAC name is dichlorotitanium;bis(5-hydroxy-2,2,6,6-tetramethylheptan-3-one).
| Compound Name | dichlorotitanium;bis(5-hydroxy-2,2,6,6-tetramethylheptan-3-one) |
|---|---|
| PubChem CID | 11156044 |
| Molecular Formula | C22H44Cl2O4Ti |
| Molecular Weight | 491.36 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | dichlorotitanium;bis(5-hydroxy-2,2,6,6-tetramethylheptan-3-one) |
| SMILES | CC(C)(C)C(=O)CC(O)C(C)(C)C.CC(C)(C)C(=O)CC(O)C(C)(C)C.Cl[Ti]Cl |
| InChI | InChI=1S/2C11H22O2.2ClH.Ti/c2*1-10(2,3)8(12)7-9(13)11(4,5)6;;;/h2*8,12H,7H2,1-6H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | XNAURLWNECMNSD-UHFFFAOYSA-L |
| XLogP | 6.17 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.36 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |