C10H13F7O2 — CID 13429305
1,1,1,2,2,3,3-heptafluoro-6-hydroxy-7,7-dimethyloctan-4-one (PubChem CID 13429305) has the molecular formula C10H13F7O2 and a molecular weight of 298.20 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-6-hydroxy-7,7-dimethyloctan-4-one.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-6-hydroxy-7,7-dimethyloctan-4-one |
|---|---|
| PubChem CID | 13429305 |
| Molecular Formula | C10H13F7O2 |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-6-hydroxy-7,7-dimethyloctan-4-one |
| SMILES | CC(C)(C)C(O)CC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F7O2/c1-7(2,3)5(18)4-6(19)8(11,12)9(13,14)10(15,16)17/h5,18H,4H2,1-3H3 |
| InChIKey | ADOVTYDIIFXULP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|