C17H13F17O4 — CID 162074940
1,1,1,2,2,6,6,7,7,7-decafluoroheptane-3,5-dione;6,6,7,7,8,8,8-heptafluoro-2,2-dimethyloctane-3,5-dione (PubChem CID 162074940) has the molecular formula C17H13F17O4 and a molecular weight of 604.25 g/mol. Its IUPAC name is 1,1,1,2,2,6,6,7,7,7-decafluoroheptane-3,5-dione;6,6,7,7,8,8,8-heptafluoro-2,2-dimethyloctane-3,5-dione.
| Compound Name | 1,1,1,2,2,6,6,7,7,7-decafluoroheptane-3,5-dione;6,6,7,7,8,8,8-heptafluoro-2,2-dimethyloctane-3,5-dione |
|---|---|
| PubChem CID | 162074940 |
| Molecular Formula | C17H13F17O4 |
| Molecular Weight | 604.25 g/mol |
| Exact Mass | 604.05 |
| IUPAC Name | 1,1,1,2,2,6,6,7,7,7-decafluoroheptane-3,5-dione;6,6,7,7,8,8,8-heptafluoro-2,2-dimethyloctane-3,5-dione |
| SMILES | CC(C)(C)C(=O)CC(=O)C(F)(F)C(F)(F)C(F)(F)F.O=C(CC(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11F7O2.C7H2F10O2/c1-7(2,3)5(18)4-6(19)8(11,12)9(13,14)10(15,16)17;8-4(9,6(12,13)14)2(18)1-3(19)5(10,11)7(15,16)17/h4H2,1-3H3;1H2 |
| InChIKey | ZBOVGJQCYHBFGP-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.25 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|