C6H5F5OS — CID 139614689
1,1,1,2,2-pentafluoro-5-sulfanylidenehexan-3-one (PubChem CID 139614689) has the molecular formula C6H5F5OS and a molecular weight of 220.16 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-5-sulfanylidenehexan-3-one.
| Compound Name | 1,1,1,2,2-pentafluoro-5-sulfanylidenehexan-3-one |
|---|---|
| PubChem CID | 139614689 |
| Molecular Formula | C6H5F5OS |
| Molecular Weight | 220.16 g/mol |
| Exact Mass | 220.00 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-5-sulfanylidenehexan-3-one |
| SMILES | CC(=S)CC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H5F5OS/c1-3(13)2-4(12)5(7,8)6(9,10)11/h2H2,1H3 |
| InChIKey | DDPFFGVNTJFJEA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.16 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|