C10H8F7LiO6 — CID 169006335
lithium 6,6,7,7,8,8,8-heptafluoro-2,2-dimethoxy-3,5-dioxooctanoate (PubChem CID 169006335) has the molecular formula C10H8F7LiO6 and a molecular weight of 364.10 g/mol. Its IUPAC name is lithium 6,6,7,7,8,8,8-heptafluoro-2,2-dimethoxy-3,5-dioxooctanoate.
| Compound Name | lithium 6,6,7,7,8,8,8-heptafluoro-2,2-dimethoxy-3,5-dioxooctanoate |
|---|---|
| PubChem CID | 169006335 |
| Molecular Formula | C10H8F7LiO6 |
| Molecular Weight | 364.10 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | lithium 6,6,7,7,8,8,8-heptafluoro-2,2-dimethoxy-3,5-dioxooctanoate |
| SMILES | COC(OC)(C(=O)[O-])C(=O)CC(=O)C(F)(F)C(F)(F)C(F)(F)F.[Li+] |
| InChI | InChI=1S/C10H9F7O6.Li/c1-22-7(23-2,6(20)21)4(18)3-5(19)8(11,12)9(13,14)10(15,16)17;/h3H2,1-2H3,(H,20,21);/q;+1/p-1 |
| InChIKey | CMMKOPPKSWTDFB-UHFFFAOYSA-M |
| XLogP | -2.91 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.10 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|