C8H8ClF7O — CID 171776124
8-chloro-1,1,1,2,2,3,3-heptafluorooctan-4-one (PubChem CID 171776124) has the molecular formula C8H8ClF7O and a molecular weight of 288.59 g/mol. Its IUPAC name is 8-chloro-1,1,1,2,2,3,3-heptafluorooctan-4-one.
| Compound Name | 8-chloro-1,1,1,2,2,3,3-heptafluorooctan-4-one |
|---|---|
| PubChem CID | 171776124 |
| Molecular Formula | C8H8ClF7O |
| Molecular Weight | 288.59 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 8-chloro-1,1,1,2,2,3,3-heptafluorooctan-4-one |
| SMILES | O=C(CCCCCl)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H8ClF7O/c9-4-2-1-3-5(17)6(10,11)7(12,13)8(14,15)16/h1-4H2 |
| InChIKey | OBUJIYRDJBPLER-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|