C21H31N5OS — CID 111569969
1-[[[N-[3-(1,3-benzothiazol-2-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide (PubChem CID 111569969) has the molecular formula C21H31N5OS and a molecular weight of 401.58 g/mol. Its IUPAC name is 1-[[[N-[3-(1,3-benzothiazol-2-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide.
| Compound Name | 1-[[[N-[3-(1,3-benzothiazol-2-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 111569969 |
| Molecular Formula | C21H31N5OS |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 1-[[[N-[3-(1,3-benzothiazol-2-yl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
| SMILES | C/N=C(/NCCCc1nc2ccccc2s1)NCC1(C(=O)N(C)C)CCCC1 |
| InChI | InChI=1S/C21H31N5OS/c1-22-20(24-15-21(12-6-7-13-21)19(27)26(2)3)23-14-8-11-18-25-16-9-4-5-10-17(16)28-18/h4-5,9-10H,6-8,11-15H2,1-3H3,(H2,22,23,24) |
| InChIKey | NFTZMTPDCAUMCB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|