C17H24ClNO3 — CID 111579334
[1-[[[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]methylamino]methyl]cyclopropyl]methanol (PubChem CID 111579334) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is [1-[[[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]methylamino]methyl]cyclopropyl]methanol.
| Compound Name | [1-[[[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]methylamino]methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 111579334 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | [1-[[[5-chloro-2-(oxolan-2-ylmethoxy)phenyl]methylamino]methyl]cyclopropyl]methanol |
| SMILES | OCC1(CNCc2cc(Cl)ccc2OCC2CCCO2)CC1 |
| InChI | InChI=1S/C17H24ClNO3/c18-14-3-4-16(22-10-15-2-1-7-21-15)13(8-14)9-19-11-17(12-20)5-6-17/h3-4,8,15,19-20H,1-2,5-7,9-12H2 |
| InChIKey | XEYSFOBZXFSIIJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |