C24H24N4O3 — CID 111598720
2-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-1-(3-phenoxyphenyl)guanidine (PubChem CID 111598720) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-1-(3-phenoxyphenyl)guanidine.
| Compound Name | 2-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-1-(3-phenoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111598720 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-1-(3-phenoxyphenyl)guanidine |
| SMILES | N/C(=N\CCOc1ccc2c(c1)CCC(=O)N2)Nc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C24H24N4O3/c25-24(27-18-5-4-8-21(16-18)31-19-6-2-1-3-7-19)26-13-14-30-20-10-11-22-17(15-20)9-12-23(29)28-22/h1-8,10-11,15-16H,9,12-14H2,(H,28,29)(H3,25,26,27) |
| InChIKey | SRFHRCXPJCDPLP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|