C22H26FN3O2 — CID 111599552
1-(3,4-dihydro-2H-chromen-4-yl)-2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]guanidine (PubChem CID 111599552) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111599552 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[4-(3-fluorophenyl)oxan-4-yl]methyl]guanidine |
| SMILES | N/C(=N\CC1(c2cccc(F)c2)CCOCC1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C22H26FN3O2/c23-17-5-3-4-16(14-17)22(9-12-27-13-10-22)15-25-21(24)26-19-8-11-28-20-7-2-1-6-18(19)20/h1-7,14,19H,8-13,15H2,(H3,24,25,26) |
| InChIKey | FIAOQMFDICBDOR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|