C16H27F3IN5OS — CID 111615923
1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111615923) has the molecular formula C16H27F3IN5OS and a molecular weight of 521.39 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111615923 |
| Molecular Formula | C16H27F3IN5OS |
| Molecular Weight | 521.39 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1CC(C)OC(C)C1)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C16H26F3N5OS.HI/c1-11-8-24(9-12(2)25-11)6-4-5-21-15(20-3)22-7-14-23-13(10-26-14)16(17,18)19;/h10-12H,4-9H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | OXVZLSFAJKABET-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|